About 2H-naphthalen-2-ide;zinc;hydrobromide
2H-naphthalen-2-ide;zinc;hydrobromide (PubChem CID 175011397) has the molecular formula C10H8BrZn-
and a molecular weight of 273.47 g/mol. Its IUPAC name is 2H-naphthalen-2-ide;zinc;hydrobromide.
Molecular Properties
| Compound Name | 2H-naphthalen-2-ide;zinc;hydrobromide |
| PubChem CID | 175011397 |
| Molecular Formula | C10H8BrZn- |
| Molecular Weight | 273.47 g/mol |
| Exact Mass | 270.91 |
| IUPAC Name | 2H-naphthalen-2-ide;zinc;hydrobromide |
| SMILES | Br.[Zn].[c-]1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H7.BrH.Zn/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-3,5-8H;1H;/q-1;; |
| InChIKey | SEONDYIZOZRWAE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2H-naphthalen-2-ide;zinc;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-naphthalen-2-ide;zinc;hydrobromide?
The IUPAC name of 2H-naphthalen-2-ide;zinc;hydrobromide (CID 175011397) is 2H-naphthalen-2-ide;zinc;hydrobromide.
What is the SMILES notation for 2H-naphthalen-2-ide;zinc;hydrobromide?
The canonical SMILES for 2H-naphthalen-2-ide;zinc;hydrobromide is Br.[Zn].[c-]1ccc2ccccc2c1.
What is the InChIKey of 2H-naphthalen-2-ide;zinc;hydrobromide?
The InChIKey is SEONDYIZOZRWAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7.BrH.Zn/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-3,5-8H;1H;/q-1;;.
What are the key properties of 2H-naphthalen-2-ide;zinc;hydrobromide?
2H-naphthalen-2-ide;zinc;hydrobromide has a molecular weight of 273.47 g/mol, XLogP of 3.22, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-naphthalen-2-ide;zinc;hydrobromide is sourced from PubChem (CID 175011397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).