About naphthalene
naphthalene (PubChem CID 10240860) has the molecular formula C10H8
and a molecular weight of 136.11 g/mol. Its IUPAC name is naphthalene.
Molecular Properties
| Compound Name | naphthalene |
| PubChem CID | 10240860 |
| Molecular Formula | C10H8 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | naphthalene |
| SMILES | c1c[13cH][13c]2[13cH][13cH][13cH][13cH][13c]2[13cH]1 |
| InChI | InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1+1,2+1,5+1,6+1,7+1,8+1,9+1,10+1 |
| InChIKey | UFWIBTONFRDIAS-SZLRDPOFSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene?
The IUPAC name of naphthalene (CID 10240860) is naphthalene.
What is the SMILES notation for naphthalene?
The canonical SMILES for naphthalene is c1c[13cH][13c]2[13cH][13cH][13cH][13cH][13c]2[13cH]1.
What is the InChIKey of naphthalene?
The InChIKey is UFWIBTONFRDIAS-SZLRDPOFSA-N. The full InChI is InChI=1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1+1,2+1,5+1,6+1,7+1,8+1,9+1,10+1.
What are the key properties of naphthalene?
naphthalene has a molecular weight of 136.11 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene is sourced from PubChem (CID 10240860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).