About naphthalene;tellane
naphthalene;tellane (PubChem CID 174343197) has the molecular formula C10H10Te
and a molecular weight of 257.79 g/mol. Its IUPAC name is naphthalene;tellane.
Molecular Properties
| Compound Name | naphthalene;tellane |
| PubChem CID | 174343197 |
| Molecular Formula | C10H10Te |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | naphthalene;tellane |
| SMILES | [TeH2].c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.H2Te/c1-2-6-10-8-4-3-7-9(10)5-1;/h1-8H;1H2 |
| InChIKey | KBAZMRJJTUCZIF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze naphthalene;tellane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;tellane?
The IUPAC name of naphthalene;tellane (CID 174343197) is naphthalene;tellane.
What is the SMILES notation for naphthalene;tellane?
The canonical SMILES for naphthalene;tellane is [TeH2].c1ccc2ccccc2c1.
What is the InChIKey of naphthalene;tellane?
The InChIKey is KBAZMRJJTUCZIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.H2Te/c1-2-6-10-8-4-3-7-9(10)5-1;/h1-8H;1H2.
What are the key properties of naphthalene;tellane?
naphthalene;tellane has a molecular weight of 257.79 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;tellane is sourced from PubChem (CID 174343197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).