About calcium-38(2+);hydride;naphthalene
calcium-38(2+);hydride;naphthalene (PubChem CID 175266851) has the molecular formula C10H10Ca
and a molecular weight of 168.17 g/mol. Its IUPAC name is calcium-38(2+);hydride;naphthalene.
Molecular Properties
| Compound Name | calcium-38(2+);hydride;naphthalene |
| PubChem CID | 175266851 |
| Molecular Formula | C10H10Ca |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | calcium-38(2+);hydride;naphthalene |
| SMILES | [38Ca+2].[H-].[H-].c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.Ca.2H/c1-2-6-10-8-4-3-7-9(10)5-1;;;/h1-8H;;;/q;+2;2*-1/i;1-2;; |
| InChIKey | SFNYDJSGJCAQIS-KBSNFJSHSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze calcium-38(2+);hydride;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium-38(2+);hydride;naphthalene?
The IUPAC name of calcium-38(2+);hydride;naphthalene (CID 175266851) is calcium-38(2+);hydride;naphthalene.
What is the SMILES notation for calcium-38(2+);hydride;naphthalene?
The canonical SMILES for calcium-38(2+);hydride;naphthalene is [38Ca+2].[H-].[H-].c1ccc2ccccc2c1.
What is the InChIKey of calcium-38(2+);hydride;naphthalene?
The InChIKey is SFNYDJSGJCAQIS-KBSNFJSHSA-N. The full InChI is InChI=1S/C10H8.Ca.2H/c1-2-6-10-8-4-3-7-9(10)5-1;;;/h1-8H;;;/q;+2;2*-1/i;1-2;;.
What are the key properties of calcium-38(2+);hydride;naphthalene?
calcium-38(2+);hydride;naphthalene has a molecular weight of 168.17 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for calcium-38(2+);hydride;naphthalene is sourced from PubChem (CID 175266851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).