About chromium(3+);naphthalene
chromium(3+);naphthalene (PubChem CID 159209740) has the molecular formula C10H8Cr+3
and a molecular weight of 180.17 g/mol. Its IUPAC name is chromium(3+);naphthalene.
Molecular Properties
| Compound Name | chromium(3+);naphthalene |
| PubChem CID | 159209740 |
| Molecular Formula | C10H8Cr+3 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | chromium(3+);naphthalene |
| SMILES | [Cr+3].c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.Cr/c1-2-6-10-8-4-3-7-9(10)5-1;/h1-8H;/q;+3 |
| InChIKey | KQIOEFWDPVCTMG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze chromium(3+);naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium(3+);naphthalene?
The IUPAC name of chromium(3+);naphthalene (CID 159209740) is chromium(3+);naphthalene.
What is the SMILES notation for chromium(3+);naphthalene?
The canonical SMILES for chromium(3+);naphthalene is [Cr+3].c1ccc2ccccc2c1.
What is the InChIKey of chromium(3+);naphthalene?
The InChIKey is KQIOEFWDPVCTMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.Cr/c1-2-6-10-8-4-3-7-9(10)5-1;/h1-8H;/q;+3.
What are the key properties of chromium(3+);naphthalene?
chromium(3+);naphthalene has a molecular weight of 180.17 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chromium(3+);naphthalene is sourced from PubChem (CID 159209740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).