About anthracene;benzene;naphthalene
anthracene;benzene;naphthalene (PubChem CID 142706236) has the molecular formula C30H24
and a molecular weight of 384.52 g/mol. Its IUPAC name is anthracene;benzene;naphthalene.
Molecular Properties
| Compound Name | anthracene;benzene;naphthalene |
| PubChem CID | 142706236 |
| Molecular Formula | C30H24 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | anthracene;benzene;naphthalene |
| SMILES | c1ccc2cc3ccccc3cc2c1.c1ccc2ccccc2c1.c1ccccc1 |
| InChI | InChI=1S/C14H10.C10H8.C6H6/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-6-10-8-4-3-7-9(10)5-1;1-2-4-6-5-3-1/h1-10H;1-8H;1-6H |
| InChIKey | LBUFUGUBSLOGNM-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;benzene;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;benzene;naphthalene?
The IUPAC name of anthracene;benzene;naphthalene (CID 142706236) is anthracene;benzene;naphthalene.
What is the SMILES notation for anthracene;benzene;naphthalene?
The canonical SMILES for anthracene;benzene;naphthalene is c1ccc2cc3ccccc3cc2c1.c1ccc2ccccc2c1.c1ccccc1.
What is the InChIKey of anthracene;benzene;naphthalene?
The InChIKey is LBUFUGUBSLOGNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C10H8.C6H6/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-6-10-8-4-3-7-9(10)5-1;1-2-4-6-5-3-1/h1-10H;1-8H;1-6H.
What are the key properties of anthracene;benzene;naphthalene?
anthracene;benzene;naphthalene has a molecular weight of 384.52 g/mol, XLogP of 8.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;benzene;naphthalene is sourced from PubChem (CID 142706236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).