About lithium anthracene
lithium anthracene (PubChem CID 22662646) has the molecular formula C14H10Li+
and a molecular weight of 185.17 g/mol. Its IUPAC name is lithium anthracene.
Molecular Properties
| Compound Name | lithium anthracene |
| PubChem CID | 22662646 |
| Molecular Formula | C14H10Li+ |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | lithium anthracene |
| SMILES | [Li+].c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.Li/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;/h1-10H;/q;+1 |
| InChIKey | PHKAIWDBWVMDQZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze lithium anthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium anthracene?
The IUPAC name of lithium anthracene (CID 22662646) is lithium anthracene.
What is the SMILES notation for lithium anthracene?
The canonical SMILES for lithium anthracene is [Li+].c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of lithium anthracene?
The InChIKey is PHKAIWDBWVMDQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.Li/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;/h1-10H;/q;+1.
What are the key properties of lithium anthracene?
lithium anthracene has a molecular weight of 185.17 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium anthracene is sourced from PubChem (CID 22662646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).