C10H6Y2-2 — CID 155760532
1,7-dihydronaphthalene-1,7-diide;bis(yttrium) (PubChem CID 155760532) has the molecular formula C10H6Y2-2 and a molecular weight of 303.97 g/mol. Its IUPAC name is 1,7-dihydronaphthalene-1,7-diide;bis(yttrium).
| Compound Name | 1,7-dihydronaphthalene-1,7-diide;bis(yttrium) |
|---|---|
| PubChem CID | 155760532 |
| Molecular Formula | C10H6Y2-2 |
| Molecular Weight | 303.97 g/mol |
| Exact Mass | 303.86 |
| IUPAC Name | 1,7-dihydronaphthalene-1,7-diide;bis(yttrium) |
| SMILES | [Y].[Y].[c-]1ccc2ccc[c-]c2c1 |
| InChI | InChI=1S/C10H6.2Y/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-3,5,7-8H;;/q-2;; |
| InChIKey | AHINVFVOSIDOMV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.97 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|