About zinc bis(1H-naphthalen-1-ide)
zinc bis(1H-naphthalen-1-ide) (PubChem CID 54742063) has the molecular formula C20H14Zn
and a molecular weight of 319.72 g/mol. Its IUPAC name is zinc bis(1H-naphthalen-1-ide).
Molecular Properties
| Compound Name | zinc bis(1H-naphthalen-1-ide) |
| PubChem CID | 54742063 |
| Molecular Formula | C20H14Zn |
| Molecular Weight | 319.72 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | zinc bis(1H-naphthalen-1-ide) |
| SMILES | [Zn+2].[c-]1cccc2ccccc12.[c-]1cccc2ccccc12 |
| InChI | InChI=1S/2C10H7.Zn/c2*1-2-6-10-8-4-3-7-9(10)5-1;/h2*1-7H;/q2*-1;+2 |
| InChIKey | XIEXKQGOAZTVME-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.72 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(1H-naphthalen-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(1H-naphthalen-1-ide)?
The IUPAC name of zinc bis(1H-naphthalen-1-ide) (CID 54742063) is zinc bis(1H-naphthalen-1-ide).
What is the SMILES notation for zinc bis(1H-naphthalen-1-ide)?
The canonical SMILES for zinc bis(1H-naphthalen-1-ide) is [Zn+2].[c-]1cccc2ccccc12.[c-]1cccc2ccccc12.
What is the InChIKey of zinc bis(1H-naphthalen-1-ide)?
The InChIKey is XIEXKQGOAZTVME-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H7.Zn/c2*1-2-6-10-8-4-3-7-9(10)5-1;/h2*1-7H;/q2*-1;+2.
What are the key properties of zinc bis(1H-naphthalen-1-ide)?
zinc bis(1H-naphthalen-1-ide) has a molecular weight of 319.72 g/mol, XLogP of 5.28, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(1H-naphthalen-1-ide) is sourced from PubChem (CID 54742063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).