About cerium;1H-phenanthren-1-ide
cerium;1H-phenanthren-1-ide (PubChem CID 175872569) has the molecular formula C14H9Ce-
and a molecular weight of 317.34 g/mol. Its IUPAC name is cerium;1H-phenanthren-1-ide.
Molecular Properties
| Compound Name | cerium;1H-phenanthren-1-ide |
| PubChem CID | 175872569 |
| Molecular Formula | C14H9Ce- |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | cerium;1H-phenanthren-1-ide |
| SMILES | [Ce].[c-]1cccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C14H9.Ce/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;/h1-5,7-10H;/q-1; |
| InChIKey | IPRKBSJVBLSQHU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze cerium;1H-phenanthren-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium;1H-phenanthren-1-ide?
The IUPAC name of cerium;1H-phenanthren-1-ide (CID 175872569) is cerium;1H-phenanthren-1-ide.
What is the SMILES notation for cerium;1H-phenanthren-1-ide?
The canonical SMILES for cerium;1H-phenanthren-1-ide is [Ce].[c-]1cccc2c1ccc1ccccc12.
What is the InChIKey of cerium;1H-phenanthren-1-ide?
The InChIKey is IPRKBSJVBLSQHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9.Ce/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;/h1-5,7-10H;/q-1;.
What are the key properties of cerium;1H-phenanthren-1-ide?
cerium;1H-phenanthren-1-ide has a molecular weight of 317.34 g/mol, XLogP of 3.79, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cerium;1H-phenanthren-1-ide is sourced from PubChem (CID 175872569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).