About phenanthrene;phosphinous acid
phenanthrene;phosphinous acid (PubChem CID 174826862) has the molecular formula C14H13OP
and a molecular weight of 228.23 g/mol. Its IUPAC name is phenanthrene;phosphinous acid.
Molecular Properties
| Compound Name | phenanthrene;phosphinous acid |
| PubChem CID | 174826862 |
| Molecular Formula | C14H13OP |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | phenanthrene;phosphinous acid |
| SMILES | OP.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.H3OP/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-2/h1-10H;1H,2H2 |
| InChIKey | FLRMNZZSDASKFO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene;phosphinous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene;phosphinous acid?
The IUPAC name of phenanthrene;phosphinous acid (CID 174826862) is phenanthrene;phosphinous acid.
What is the SMILES notation for phenanthrene;phosphinous acid?
The canonical SMILES for phenanthrene;phosphinous acid is OP.c1ccc2c(c1)ccc1ccccc12.
What is the InChIKey of phenanthrene;phosphinous acid?
The InChIKey is FLRMNZZSDASKFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.H3OP/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-2/h1-10H;1H,2H2.
What are the key properties of phenanthrene;phosphinous acid?
phenanthrene;phosphinous acid has a molecular weight of 228.23 g/mol, XLogP of 3.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene;phosphinous acid is sourced from PubChem (CID 174826862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).