About phenanthrene;pyrene;triphenylene
phenanthrene;pyrene;triphenylene (PubChem CID 162115949) has the molecular formula C96H62
and a molecular weight of 1215.55 g/mol. Its IUPAC name is phenanthrene;pyrene;triphenylene.
Molecular Properties
| Compound Name | phenanthrene;pyrene;triphenylene |
| PubChem CID | 162115949 |
| Molecular Formula | C96H62 |
| Molecular Weight | 1215.55 g/mol |
| Exact Mass | 1214.49 |
| IUPAC Name | phenanthrene;pyrene;triphenylene |
| SMILES | c1cc2ccc3cccc4ccc(c1)c2c34.c1cc2ccc3cccc4ccc(c1)c2c34.c1cc2ccc3cccc4ccc(c1)c2c34.c1cc2ccc3cccc4ccc(c1)c2c34.c1ccc2c(c1)c1ccccc1c1ccccc21.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C18H12.4C16H10.C14H10/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18;4*1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-12H;4*1-10H;1-10H |
| InChIKey | ZGTMQLQZERPMMY-UHFFFAOYSA-N |
| XLogP | 27.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 96 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1215.55 |
| LogP ≤ 5 | 27.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene;pyrene;triphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene;pyrene;triphenylene?
The IUPAC name of phenanthrene;pyrene;triphenylene (CID 162115949) is phenanthrene;pyrene;triphenylene.
What is the SMILES notation for phenanthrene;pyrene;triphenylene?
The canonical SMILES for phenanthrene;pyrene;triphenylene is c1cc2ccc3cccc4ccc(c1)c2c34.c1cc2ccc3cccc4ccc(c1)c2c34.c1cc2ccc3cccc4ccc(c1)c2c34.c1cc2ccc3cccc4ccc(c1)c2c34.c1ccc2c(c1)c1ccccc1c1ccccc21.c1ccc2c(c1)ccc1ccccc12.
What is the InChIKey of phenanthrene;pyrene;triphenylene?
The InChIKey is ZGTMQLQZERPMMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12.4C16H10.C14H10/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18;4*1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-12H;4*1-10H;1-10H.
What are the key properties of phenanthrene;pyrene;triphenylene?
phenanthrene;pyrene;triphenylene has a molecular weight of 1215.55 g/mol, XLogP of 27.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene;pyrene;triphenylene is sourced from PubChem (CID 162115949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).