About phenanthrene;sulfane
phenanthrene;sulfane (PubChem CID 159172584) has the molecular formula C14H12S
and a molecular weight of 212.32 g/mol. Its IUPAC name is phenanthrene;sulfane.
Molecular Properties
| Compound Name | phenanthrene;sulfane |
| PubChem CID | 159172584 |
| Molecular Formula | C14H12S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | phenanthrene;sulfane |
| SMILES | S.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.H2S/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;/h1-10H;1H2 |
| InChIKey | FJDQTISAHMEXMI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene;sulfane?
The IUPAC name of phenanthrene;sulfane (CID 159172584) is phenanthrene;sulfane.
What is the SMILES notation for phenanthrene;sulfane?
The canonical SMILES for phenanthrene;sulfane is S.c1ccc2c(c1)ccc1ccccc12.
What is the InChIKey of phenanthrene;sulfane?
The InChIKey is FJDQTISAHMEXMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.H2S/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;/h1-10H;1H2.
What are the key properties of phenanthrene;sulfane?
phenanthrene;sulfane has a molecular weight of 212.32 g/mol, XLogP of 4.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene;sulfane is sourced from PubChem (CID 159172584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).