About anthracene;naphthalene;phenanthrene
anthracene;naphthalene;phenanthrene (PubChem CID 158591187) has the molecular formula C38H28
and a molecular weight of 484.64 g/mol. Its IUPAC name is anthracene;naphthalene;phenanthrene.
Molecular Properties
| Compound Name | anthracene;naphthalene;phenanthrene |
| PubChem CID | 158591187 |
| Molecular Formula | C38H28 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | anthracene;naphthalene;phenanthrene |
| SMILES | c1ccc2c(c1)ccc1ccccc12.c1ccc2cc3ccccc3cc2c1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/2C14H10.C10H8/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-6-10-8-4-3-7-9(10)5-1/h2*1-10H;1-8H |
| InChIKey | HULQCPMWYRPUQZ-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze anthracene;naphthalene;phenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;naphthalene;phenanthrene?
The IUPAC name of anthracene;naphthalene;phenanthrene (CID 158591187) is anthracene;naphthalene;phenanthrene.
What is the SMILES notation for anthracene;naphthalene;phenanthrene?
The canonical SMILES for anthracene;naphthalene;phenanthrene is c1ccc2c(c1)ccc1ccccc12.c1ccc2cc3ccccc3cc2c1.c1ccc2ccccc2c1.
What is the InChIKey of anthracene;naphthalene;phenanthrene?
The InChIKey is HULQCPMWYRPUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H10.C10H8/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-2-6-10-8-4-3-7-9(10)5-1/h2*1-10H;1-8H.
What are the key properties of anthracene;naphthalene;phenanthrene?
anthracene;naphthalene;phenanthrene has a molecular weight of 484.64 g/mol, XLogP of 10.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;naphthalene;phenanthrene is sourced from PubChem (CID 158591187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).