About benzo[a]anthracene;hydrobromide
benzo[a]anthracene;hydrobromide (PubChem CID 159787028) has the molecular formula C18H13Br
and a molecular weight of 309.21 g/mol. Its IUPAC name is benzo[a]anthracene;hydrobromide.
Molecular Properties
| Compound Name | benzo[a]anthracene;hydrobromide |
| PubChem CID | 159787028 |
| Molecular Formula | C18H13Br |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | benzo[a]anthracene;hydrobromide |
| SMILES | Br.c1ccc2cc3c(ccc4ccccc43)cc2c1 |
| InChI | InChI=1S/C18H12.BrH/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18;/h1-12H;1H |
| InChIKey | OBQKDBHWEIFLSU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[a]anthracene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[a]anthracene;hydrobromide?
The IUPAC name of benzo[a]anthracene;hydrobromide (CID 159787028) is benzo[a]anthracene;hydrobromide.
What is the SMILES notation for benzo[a]anthracene;hydrobromide?
The canonical SMILES for benzo[a]anthracene;hydrobromide is Br.c1ccc2cc3c(ccc4ccccc43)cc2c1.
What is the InChIKey of benzo[a]anthracene;hydrobromide?
The InChIKey is OBQKDBHWEIFLSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12.BrH/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18;/h1-12H;1H.
What are the key properties of benzo[a]anthracene;hydrobromide?
benzo[a]anthracene;hydrobromide has a molecular weight of 309.21 g/mol, XLogP of 5.72, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[a]anthracene;hydrobromide is sourced from PubChem (CID 159787028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).