About phenanthrene;phosphane
phenanthrene;phosphane (PubChem CID 161431298) has the molecular formula C14H13P
and a molecular weight of 212.23 g/mol. Its IUPAC name is phenanthrene;phosphane.
Molecular Properties
| Compound Name | phenanthrene;phosphane |
| PubChem CID | 161431298 |
| Molecular Formula | C14H13P |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | phenanthrene;phosphane |
| SMILES | P.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.H3P/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;/h1-10H;1H3 |
| InChIKey | VYAWNUGJSVJTSU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene;phosphane?
The IUPAC name of phenanthrene;phosphane (CID 161431298) is phenanthrene;phosphane.
What is the SMILES notation for phenanthrene;phosphane?
The canonical SMILES for phenanthrene;phosphane is P.c1ccc2c(c1)ccc1ccccc12.
What is the InChIKey of phenanthrene;phosphane?
The InChIKey is VYAWNUGJSVJTSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.H3P/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;/h1-10H;1H3.
What are the key properties of phenanthrene;phosphane?
phenanthrene;phosphane has a molecular weight of 212.23 g/mol, XLogP of 4.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene;phosphane is sourced from PubChem (CID 161431298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).