About 1,1'-biphenyl;naphthalene;phenanthrene
1,1'-biphenyl;naphthalene;phenanthrene (PubChem CID 157410235) has the molecular formula C36H28
and a molecular weight of 460.62 g/mol. Its IUPAC name is 1,1'-biphenyl;naphthalene;phenanthrene.
Molecular Properties
| Compound Name | 1,1'-biphenyl;naphthalene;phenanthrene |
| PubChem CID | 157410235 |
| Molecular Formula | C36H28 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 1,1'-biphenyl;naphthalene;phenanthrene |
| SMILES | c1ccc(-c2ccccc2)cc1.c1ccc2c(c1)ccc1ccccc12.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H10.C12H10.C10H8/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-8-4-3-7-9(10)5-1/h1-10H;1-10H;1-8H |
| InChIKey | BOERESLGOPHLBP-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;naphthalene;phenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;naphthalene;phenanthrene?
The IUPAC name of 1,1'-biphenyl;naphthalene;phenanthrene (CID 157410235) is 1,1'-biphenyl;naphthalene;phenanthrene.
What is the SMILES notation for 1,1'-biphenyl;naphthalene;phenanthrene?
The canonical SMILES for 1,1'-biphenyl;naphthalene;phenanthrene is c1ccc(-c2ccccc2)cc1.c1ccc2c(c1)ccc1ccccc12.c1ccc2ccccc2c1.
What is the InChIKey of 1,1'-biphenyl;naphthalene;phenanthrene?
The InChIKey is BOERESLGOPHLBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C12H10.C10H8/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-8-4-3-7-9(10)5-1/h1-10H;1-10H;1-8H.
What are the key properties of 1,1'-biphenyl;naphthalene;phenanthrene?
1,1'-biphenyl;naphthalene;phenanthrene has a molecular weight of 460.62 g/mol, XLogP of 10.19, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;naphthalene;phenanthrene is sourced from PubChem (CID 157410235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).