About CID 172725087
CID 172725087 (PubChem CID 172725087) has the molecular formula C22H18Li2
and a molecular weight of 296.27 g/mol.
Molecular Properties
| Compound Name | CID 172725087 |
| PubChem CID | 172725087 |
| Molecular Formula | C22H18Li2 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | — |
| SMILES | [Li].[Li].c1ccc(-c2ccccc2)cc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H10.C10H8.2Li/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-8-4-3-7-9(10)5-1;;/h1-10H;1-8H;; |
| InChIKey | HAQHHBMPLRCNPX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 172725087 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172725087?
The IUPAC name of CID 172725087 (CID 172725087) is not available.
What is the SMILES notation for CID 172725087?
The canonical SMILES for CID 172725087 is [Li].[Li].c1ccc(-c2ccccc2)cc1.c1ccc2ccccc2c1.
What is the InChIKey of CID 172725087?
The InChIKey is HAQHHBMPLRCNPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C10H8.2Li/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-8-4-3-7-9(10)5-1;;/h1-10H;1-8H;;.
What are the key properties of CID 172725087?
CID 172725087 has a molecular weight of 296.27 g/mol, XLogP of 5.43, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172725087 is sourced from PubChem (CID 172725087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).