About 1,1'-biphenyl;indigane
1,1'-biphenyl;indigane (PubChem CID 174363765) has the molecular formula C12H13In
and a molecular weight of 272.05 g/mol. Its IUPAC name is 1,1'-biphenyl;indigane.
Molecular Properties
| Compound Name | 1,1'-biphenyl;indigane |
| PubChem CID | 174363765 |
| Molecular Formula | C12H13In |
| Molecular Weight | 272.05 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 1,1'-biphenyl;indigane |
| SMILES | [InH3].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.In.3H/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;;;;/h1-10H;;;; |
| InChIKey | YBFOICDCEIYTLB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.05 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1'-biphenyl;indigane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;indigane?
The IUPAC name of 1,1'-biphenyl;indigane (CID 174363765) is 1,1'-biphenyl;indigane.
What is the SMILES notation for 1,1'-biphenyl;indigane?
The canonical SMILES for 1,1'-biphenyl;indigane is [InH3].c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;indigane?
The InChIKey is YBFOICDCEIYTLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.In.3H/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;;;;/h1-10H;;;;.
What are the key properties of 1,1'-biphenyl;indigane?
1,1'-biphenyl;indigane has a molecular weight of 272.05 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;indigane is sourced from PubChem (CID 174363765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).