About 1,1'-biphenyl;molecular hydrogen
1,1'-biphenyl;molecular hydrogen (PubChem CID 173033571) has the molecular formula C12H12
and a molecular weight of 156.23 g/mol. Its IUPAC name is 1,1'-biphenyl;molecular hydrogen.
Molecular Properties
| Compound Name | 1,1'-biphenyl;molecular hydrogen |
| PubChem CID | 173033571 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1,1'-biphenyl;molecular hydrogen |
| SMILES | [H][H].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.H2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-10H;1H |
| InChIKey | CMCYKEDMJLEMPJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1'-biphenyl;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;molecular hydrogen?
The IUPAC name of 1,1'-biphenyl;molecular hydrogen (CID 173033571) is 1,1'-biphenyl;molecular hydrogen.
What is the SMILES notation for 1,1'-biphenyl;molecular hydrogen?
The canonical SMILES for 1,1'-biphenyl;molecular hydrogen is [H][H].c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;molecular hydrogen?
The InChIKey is CMCYKEDMJLEMPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.H2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-10H;1H.
What are the key properties of 1,1'-biphenyl;molecular hydrogen?
1,1'-biphenyl;molecular hydrogen has a molecular weight of 156.23 g/mol, XLogP of 3.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;molecular hydrogen is sourced from PubChem (CID 173033571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).