1,1'-biphenyl;molecular hydrogen

C12H12 — CID 173033571

IUPAC1,1'-biphenyl;molecular hydrogen
SMILES[H][H].c1ccc(-c2ccccc2)cc1
InChIInChI=1S/C12H10.H2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-10H;1H
InChIKeyCMCYKEDMJLEMPJ-UHFFFAOYSA-N
MW156.23 g/mol
LogP3.60
Rot. Bonds1

About 1,1'-biphenyl;molecular hydrogen

1,1'-biphenyl;molecular hydrogen (PubChem CID 173033571) has the molecular formula C12H12 and a molecular weight of 156.23 g/mol. Its IUPAC name is 1,1'-biphenyl;molecular hydrogen.

Molecular Properties

Compound Name1,1'-biphenyl;molecular hydrogen
PubChem CID173033571
Molecular FormulaC12H12
Molecular Weight156.23 g/mol
Exact Mass156.09
IUPAC Name1,1'-biphenyl;molecular hydrogen
SMILES[H][H].c1ccc(-c2ccccc2)cc1
InChIInChI=1S/C12H10.H2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-10H;1H
InChIKeyCMCYKEDMJLEMPJ-UHFFFAOYSA-N
XLogP3.60
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.23
LogP ≤ 53.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze 1,1'-biphenyl;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1'-biphenyl;molecular hydrogen?
The IUPAC name of 1,1'-biphenyl;molecular hydrogen (CID 173033571) is 1,1'-biphenyl;molecular hydrogen.
What is the SMILES notation for 1,1'-biphenyl;molecular hydrogen?
The canonical SMILES for 1,1'-biphenyl;molecular hydrogen is [H][H].c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;molecular hydrogen?
The InChIKey is CMCYKEDMJLEMPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.H2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-10H;1H.
What are the key properties of 1,1'-biphenyl;molecular hydrogen?
1,1'-biphenyl;molecular hydrogen has a molecular weight of 156.23 g/mol, XLogP of 3.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;molecular hydrogen is sourced from PubChem (CID 173033571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).