About beryllium;1,1'-biphenyl;hydride
beryllium;1,1'-biphenyl;hydride (PubChem CID 173156439) has the molecular formula C12H12Be
and a molecular weight of 165.24 g/mol. Its IUPAC name is beryllium;1,1'-biphenyl;hydride.
Molecular Properties
| Compound Name | beryllium;1,1'-biphenyl;hydride |
| PubChem CID | 173156439 |
| Molecular Formula | C12H12Be |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.11 |
| IUPAC Name | beryllium;1,1'-biphenyl;hydride |
| SMILES | [Be+2].[H-].[H-].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.Be.2H/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;;;/h1-10H;;;/q;+2;2*-1 |
| InChIKey | MSBCAQFTSKVOHC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze beryllium;1,1'-biphenyl;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium;1,1'-biphenyl;hydride?
The IUPAC name of beryllium;1,1'-biphenyl;hydride (CID 173156439) is beryllium;1,1'-biphenyl;hydride.
What is the SMILES notation for beryllium;1,1'-biphenyl;hydride?
The canonical SMILES for beryllium;1,1'-biphenyl;hydride is [Be+2].[H-].[H-].c1ccc(-c2ccccc2)cc1.
What is the InChIKey of beryllium;1,1'-biphenyl;hydride?
The InChIKey is MSBCAQFTSKVOHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.Be.2H/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;;;/h1-10H;;;/q;+2;2*-1.
What are the key properties of beryllium;1,1'-biphenyl;hydride?
beryllium;1,1'-biphenyl;hydride has a molecular weight of 165.24 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium;1,1'-biphenyl;hydride is sourced from PubChem (CID 173156439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).