About CID 53446764
CID 53446764 (PubChem CID 53446764) has the molecular formula C12H10Na
and a molecular weight of 177.20 g/mol.
Molecular Properties
| Compound Name | CID 53446764 |
| PubChem CID | 53446764 |
| Molecular Formula | C12H10Na |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | — |
| SMILES | [Na].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.Na/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-10H; |
| InChIKey | AEBYJSOWHQYRPK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 53446764 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 53446764?
The IUPAC name of CID 53446764 (CID 53446764) is not available.
What is the SMILES notation for CID 53446764?
The canonical SMILES for CID 53446764 is [Na].c1ccc(-c2ccccc2)cc1.
What is the InChIKey of CID 53446764?
The InChIKey is AEBYJSOWHQYRPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.Na/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-10H;.
What are the key properties of CID 53446764?
CID 53446764 has a molecular weight of 177.20 g/mol, XLogP of 2.97, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 53446764 is sourced from PubChem (CID 53446764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).