About 1,1'-biphenyl;hydroiodide
1,1'-biphenyl;hydroiodide (PubChem CID 66586334) has the molecular formula C12H11I
and a molecular weight of 282.12 g/mol. Its IUPAC name is 1,1'-biphenyl;hydroiodide.
Molecular Properties
| Compound Name | 1,1'-biphenyl;hydroiodide |
| PubChem CID | 66586334 |
| Molecular Formula | C12H11I |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 1,1'-biphenyl;hydroiodide |
| SMILES | I.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.HI/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-10H;1H |
| InChIKey | RFLYLFBIMQTLSF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;hydroiodide?
The IUPAC name of 1,1'-biphenyl;hydroiodide (CID 66586334) is 1,1'-biphenyl;hydroiodide.
What is the SMILES notation for 1,1'-biphenyl;hydroiodide?
The canonical SMILES for 1,1'-biphenyl;hydroiodide is I.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;hydroiodide?
The InChIKey is RFLYLFBIMQTLSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.HI/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-10H;1H.
What are the key properties of 1,1'-biphenyl;hydroiodide?
1,1'-biphenyl;hydroiodide has a molecular weight of 282.12 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;hydroiodide is sourced from PubChem (CID 66586334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).