About 1,1'-biphenyl;naphthalene;phenol
1,1'-biphenyl;naphthalene;phenol (PubChem CID 159002551) has the molecular formula C34H30O2
and a molecular weight of 470.61 g/mol. Its IUPAC name is 1,1'-biphenyl;naphthalene;phenol.
Molecular Properties
| Compound Name | 1,1'-biphenyl;naphthalene;phenol |
| PubChem CID | 159002551 |
| Molecular Formula | C34H30O2 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1,1'-biphenyl;naphthalene;phenol |
| SMILES | Oc1ccccc1.Oc1ccccc1.c1ccc(-c2ccccc2)cc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H10.C10H8.2C6H6O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-8-4-3-7-9(10)5-1;2*7-6-4-2-1-3-5-6/h1-10H;1-8H;2*1-5,7H |
| InChIKey | JRMZAGOFCYOYNP-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1'-biphenyl;naphthalene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;naphthalene;phenol?
The IUPAC name of 1,1'-biphenyl;naphthalene;phenol (CID 159002551) is 1,1'-biphenyl;naphthalene;phenol.
What is the SMILES notation for 1,1'-biphenyl;naphthalene;phenol?
The canonical SMILES for 1,1'-biphenyl;naphthalene;phenol is Oc1ccccc1.Oc1ccccc1.c1ccc(-c2ccccc2)cc1.c1ccc2ccccc2c1.
What is the InChIKey of 1,1'-biphenyl;naphthalene;phenol?
The InChIKey is JRMZAGOFCYOYNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C10H8.2C6H6O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-8-4-3-7-9(10)5-1;2*7-6-4-2-1-3-5-6/h1-10H;1-8H;2*1-5,7H.
What are the key properties of 1,1'-biphenyl;naphthalene;phenol?
1,1'-biphenyl;naphthalene;phenol has a molecular weight of 470.61 g/mol, XLogP of 8.98, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;naphthalene;phenol is sourced from PubChem (CID 159002551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).