About benzene;1,1'-biphenyl;phenol
benzene;1,1'-biphenyl;phenol (PubChem CID 159528072) has the molecular formula C24H22O
and a molecular weight of 326.44 g/mol. Its IUPAC name is benzene;1,1'-biphenyl;phenol.
Molecular Properties
| Compound Name | benzene;1,1'-biphenyl;phenol |
| PubChem CID | 159528072 |
| Molecular Formula | C24H22O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | benzene;1,1'-biphenyl;phenol |
| SMILES | Oc1ccccc1.c1ccc(-c2ccccc2)cc1.c1ccccc1 |
| InChI | InChI=1S/C12H10.C6H6O.C6H6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-6-4-2-1-3-5-6;1-2-4-6-5-3-1/h1-10H;1-5,7H;1-6H |
| InChIKey | MCQCAHBPVYYTTN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;1,1'-biphenyl;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1,1'-biphenyl;phenol?
The IUPAC name of benzene;1,1'-biphenyl;phenol (CID 159528072) is benzene;1,1'-biphenyl;phenol.
What is the SMILES notation for benzene;1,1'-biphenyl;phenol?
The canonical SMILES for benzene;1,1'-biphenyl;phenol is Oc1ccccc1.c1ccc(-c2ccccc2)cc1.c1ccccc1.
What is the InChIKey of benzene;1,1'-biphenyl;phenol?
The InChIKey is MCQCAHBPVYYTTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C6H6O.C6H6/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;7-6-4-2-1-3-5-6;1-2-4-6-5-3-1/h1-10H;1-5,7H;1-6H.
What are the key properties of benzene;1,1'-biphenyl;phenol?
benzene;1,1'-biphenyl;phenol has a molecular weight of 326.44 g/mol, XLogP of 6.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1,1'-biphenyl;phenol is sourced from PubChem (CID 159528072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).