About benzo[e]pyrene;phenazine
benzo[e]pyrene;phenazine (PubChem CID 174928113) has the molecular formula C32H20N2
and a molecular weight of 432.53 g/mol. Its IUPAC name is benzo[e]pyrene;phenazine.
Molecular Properties
| Compound Name | benzo[e]pyrene;phenazine |
| PubChem CID | 174928113 |
| Molecular Formula | C32H20N2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | benzo[e]pyrene;phenazine |
| SMILES | c1ccc2c(c1)c1cccc3ccc4cccc2c4c31.c1ccc2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C20H12.C12H8N2/c1-2-8-16-15(7-1)17-9-3-5-13-11-12-14-6-4-10-18(16)20(14)19(13)17;1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-12H;1-8H |
| InChIKey | FUWBYHDURMEXEC-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[e]pyrene;phenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[e]pyrene;phenazine?
The IUPAC name of benzo[e]pyrene;phenazine (CID 174928113) is benzo[e]pyrene;phenazine.
What is the SMILES notation for benzo[e]pyrene;phenazine?
The canonical SMILES for benzo[e]pyrene;phenazine is c1ccc2c(c1)c1cccc3ccc4cccc2c4c31.c1ccc2nc3ccccc3nc2c1.
What is the InChIKey of benzo[e]pyrene;phenazine?
The InChIKey is FUWBYHDURMEXEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.C12H8N2/c1-2-8-16-15(7-1)17-9-3-5-13-11-12-14-6-4-10-18(16)20(14)19(13)17;1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h1-12H;1-8H.
What are the key properties of benzo[e]pyrene;phenazine?
benzo[e]pyrene;phenazine has a molecular weight of 432.53 g/mol, XLogP of 8.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[e]pyrene;phenazine is sourced from PubChem (CID 174928113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).