About phenanthrene;phosphenous acid
phenanthrene;phosphenous acid (PubChem CID 174573488) has the molecular formula C14H11O2P
and a molecular weight of 242.21 g/mol. Its IUPAC name is phenanthrene;phosphenous acid.
Molecular Properties
| Compound Name | phenanthrene;phosphenous acid |
| PubChem CID | 174573488 |
| Molecular Formula | C14H11O2P |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | phenanthrene;phosphenous acid |
| SMILES | O=PO.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.HO2P/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-3-2/h1-10H;(H,1,2) |
| InChIKey | DPAWWLDAMKVROA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene;phosphenous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene;phosphenous acid?
The IUPAC name of phenanthrene;phosphenous acid (CID 174573488) is phenanthrene;phosphenous acid.
What is the SMILES notation for phenanthrene;phosphenous acid?
The canonical SMILES for phenanthrene;phosphenous acid is O=PO.c1ccc2c(c1)ccc1ccccc12.
What is the InChIKey of phenanthrene;phosphenous acid?
The InChIKey is DPAWWLDAMKVROA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.HO2P/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-3-2/h1-10H;(H,1,2).
What are the key properties of phenanthrene;phosphenous acid?
phenanthrene;phosphenous acid has a molecular weight of 242.21 g/mol, XLogP of 4.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene;phosphenous acid is sourced from PubChem (CID 174573488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).