About isocyanic acid;phenanthrene
isocyanic acid;phenanthrene (PubChem CID 172832976) has the molecular formula C16H12N2O2
and a molecular weight of 264.28 g/mol. Its IUPAC name is isocyanic acid;phenanthrene.
Molecular Properties
| Compound Name | isocyanic acid;phenanthrene |
| PubChem CID | 172832976 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | isocyanic acid;phenanthrene |
| SMILES | N=C=O.N=C=O.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.2CHNO/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;2*2-1-3/h1-10H;2*2H |
| InChIKey | VTLRFFBGNFASAX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;phenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;phenanthrene?
The IUPAC name of isocyanic acid;phenanthrene (CID 172832976) is isocyanic acid;phenanthrene.
What is the SMILES notation for isocyanic acid;phenanthrene?
The canonical SMILES for isocyanic acid;phenanthrene is N=C=O.N=C=O.c1ccc2c(c1)ccc1ccccc12.
What is the InChIKey of isocyanic acid;phenanthrene?
The InChIKey is VTLRFFBGNFASAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.2CHNO/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;2*2-1-3/h1-10H;2*2H.
What are the key properties of isocyanic acid;phenanthrene?
isocyanic acid;phenanthrene has a molecular weight of 264.28 g/mol, XLogP of 3.79, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;phenanthrene is sourced from PubChem (CID 172832976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).