About lithium 8H-naphthalen-8-ide-2-sulfonic acid
lithium 8H-naphthalen-8-ide-2-sulfonic acid (PubChem CID 174758824) has the molecular formula C10H7LiO3S
and a molecular weight of 214.17 g/mol. Its IUPAC name is lithium 8H-naphthalen-8-ide-2-sulfonic acid.
Molecular Properties
| Compound Name | lithium 8H-naphthalen-8-ide-2-sulfonic acid |
| PubChem CID | 174758824 |
| Molecular Formula | C10H7LiO3S |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | lithium 8H-naphthalen-8-ide-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2ccc[c-]c2c1.[Li+] |
| InChI | InChI=1S/C10H7O3S.Li/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10;/h1-3,5-7H,(H,11,12,13);/q-1;+1 |
| InChIKey | OQFRRHXJGNQUOI-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze lithium 8H-naphthalen-8-ide-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 8H-naphthalen-8-ide-2-sulfonic acid?
The IUPAC name of lithium 8H-naphthalen-8-ide-2-sulfonic acid (CID 174758824) is lithium 8H-naphthalen-8-ide-2-sulfonic acid.
What is the SMILES notation for lithium 8H-naphthalen-8-ide-2-sulfonic acid?
The canonical SMILES for lithium 8H-naphthalen-8-ide-2-sulfonic acid is O=S(=O)(O)c1ccc2ccc[c-]c2c1.[Li+].
What is the InChIKey of lithium 8H-naphthalen-8-ide-2-sulfonic acid?
The InChIKey is OQFRRHXJGNQUOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7O3S.Li/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10;/h1-3,5-7H,(H,11,12,13);/q-1;+1.
What are the key properties of lithium 8H-naphthalen-8-ide-2-sulfonic acid?
lithium 8H-naphthalen-8-ide-2-sulfonic acid has a molecular weight of 214.17 g/mol, XLogP of -1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 8H-naphthalen-8-ide-2-sulfonic acid is sourced from PubChem (CID 174758824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).