C10H9NaO6S2 — CID 173344395
sodium;hydride;naphthalene-1,7-disulfonic acid (PubChem CID 173344395) has the molecular formula C10H9NaO6S2 and a molecular weight of 312.30 g/mol. Its IUPAC name is sodium;hydride;naphthalene-1,7-disulfonic acid.
| Compound Name | sodium;hydride;naphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 173344395 |
| Molecular Formula | C10H9NaO6S2 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | sodium;hydride;naphthalene-1,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2cccc(S(=O)(=O)O)c2c1.[H-].[Na+] |
| InChI | InChI=1S/C10H8O6S2.Na.H/c11-17(12,13)8-5-4-7-2-1-3-10(9(7)6-8)18(14,15)16;;/h1-6H,(H,11,12,13)(H,14,15,16);;/q;+1;-1 |
| InChIKey | PMWGEHTVRUBFKE-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|