C21H16O6S2 — CID 22833442
8-[(6-sulfonaphthalen-1-yl)methyl]naphthalene-2-sulfonic acid (PubChem CID 22833442) has the molecular formula C21H16O6S2 and a molecular weight of 428.49 g/mol. Its IUPAC name is 8-[(6-sulfonaphthalen-1-yl)methyl]naphthalene-2-sulfonic acid.
| Compound Name | 8-[(6-sulfonaphthalen-1-yl)methyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 22833442 |
| Molecular Formula | C21H16O6S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 8-[(6-sulfonaphthalen-1-yl)methyl]naphthalene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(Cc3cccc4ccc(S(=O)(=O)O)cc34)cccc2c1 |
| InChI | InChI=1S/C21H16O6S2/c22-28(23,24)18-9-10-20-15(4-2-6-17(20)12-18)11-16-5-1-3-14-7-8-19(13-21(14)16)29(25,26)27/h1-10,12-13H,11H2,(H,22,23,24)(H,25,26,27) |
| InChIKey | CCHJKYNRBYHJAU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|