About potassium;hydride;naphthalene-1-sulfonic acid
potassium;hydride;naphthalene-1-sulfonic acid (PubChem CID 173036389) has the molecular formula C10H9KO3S
and a molecular weight of 248.34 g/mol. Its IUPAC name is potassium;hydride;naphthalene-1-sulfonic acid.
Molecular Properties
| Compound Name | potassium;hydride;naphthalene-1-sulfonic acid |
| PubChem CID | 173036389 |
| Molecular Formula | C10H9KO3S |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | potassium;hydride;naphthalene-1-sulfonic acid |
| SMILES | O=S(=O)(O)c1cccc2ccccc12.[H-].[K+] |
| InChI | InChI=1S/C10H8O3S.K.H/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H,(H,11,12,13);;/q;+1;-1 |
| InChIKey | MDIQUJDXVWLACE-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;naphthalene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;naphthalene-1-sulfonic acid?
The IUPAC name of potassium;hydride;naphthalene-1-sulfonic acid (CID 173036389) is potassium;hydride;naphthalene-1-sulfonic acid.
What is the SMILES notation for potassium;hydride;naphthalene-1-sulfonic acid?
The canonical SMILES for potassium;hydride;naphthalene-1-sulfonic acid is O=S(=O)(O)c1cccc2ccccc12.[H-].[K+].
What is the InChIKey of potassium;hydride;naphthalene-1-sulfonic acid?
The InChIKey is MDIQUJDXVWLACE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3S.K.H/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7H,(H,11,12,13);;/q;+1;-1.
What are the key properties of potassium;hydride;naphthalene-1-sulfonic acid?
potassium;hydride;naphthalene-1-sulfonic acid has a molecular weight of 248.34 g/mol, XLogP of -0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;naphthalene-1-sulfonic acid is sourced from PubChem (CID 173036389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).