About bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid
bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid (PubChem CID 87267180) has the molecular formula C18H24O3S
and a molecular weight of 320.45 g/mol. Its IUPAC name is bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid.
Molecular Properties
| Compound Name | bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid |
| PubChem CID | 87267180 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid |
| SMILES | C=C(C)C.C=C(C)C.O=S(=O)(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O3S.2C4H8/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;2*1-4(2)3/h1-7H,(H,11,12,13);2*1H2,2-3H3 |
| InChIKey | VKKXREABWZPFQJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid?
The IUPAC name of bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid (CID 87267180) is bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid.
What is the SMILES notation for bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid?
The canonical SMILES for bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid is C=C(C)C.C=C(C)C.O=S(=O)(O)c1cccc2ccccc12.
What is the InChIKey of bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid?
The InChIKey is VKKXREABWZPFQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3S.2C4H8/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;2*1-4(2)3/h1-7H,(H,11,12,13);2*1H2,2-3H3.
What are the key properties of bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid?
bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid has a molecular weight of 320.45 g/mol, XLogP of 5.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylprop-1-ene);naphthalene-1-sulfonic acid is sourced from PubChem (CID 87267180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).