About sodium;butane;naphthalene-1-sulfonic acid
sodium;butane;naphthalene-1-sulfonic acid (PubChem CID 162256815) has the molecular formula C14H17NaO3S
and a molecular weight of 288.34 g/mol. Its IUPAC name is sodium;butane;naphthalene-1-sulfonic acid.
Molecular Properties
| Compound Name | sodium;butane;naphthalene-1-sulfonic acid |
| PubChem CID | 162256815 |
| Molecular Formula | C14H17NaO3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | sodium;butane;naphthalene-1-sulfonic acid |
| SMILES | C[CH-]CC.O=S(=O)(O)c1cccc2ccccc12.[Na+] |
| InChI | InChI=1S/C10H8O3S.C4H9.Na/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;1-3-4-2;/h1-7H,(H,11,12,13);3H,4H2,1-2H3;/q;-1;+1 |
| InChIKey | OAGNFQFUSBBATN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;butane;naphthalene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;butane;naphthalene-1-sulfonic acid?
The IUPAC name of sodium;butane;naphthalene-1-sulfonic acid (CID 162256815) is sodium;butane;naphthalene-1-sulfonic acid.
What is the SMILES notation for sodium;butane;naphthalene-1-sulfonic acid?
The canonical SMILES for sodium;butane;naphthalene-1-sulfonic acid is C[CH-]CC.O=S(=O)(O)c1cccc2ccccc12.[Na+].
What is the InChIKey of sodium;butane;naphthalene-1-sulfonic acid?
The InChIKey is OAGNFQFUSBBATN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3S.C4H9.Na/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;1-3-4-2;/h1-7H,(H,11,12,13);3H,4H2,1-2H3;/q;-1;+1.
What are the key properties of sodium;butane;naphthalene-1-sulfonic acid?
sodium;butane;naphthalene-1-sulfonic acid has a molecular weight of 288.34 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;butane;naphthalene-1-sulfonic acid is sourced from PubChem (CID 162256815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).