About sodium;naphthalene-1-sulfonic acid;nonane
sodium;naphthalene-1-sulfonic acid;nonane (PubChem CID 159063817) has the molecular formula C19H27NaO3S
and a molecular weight of 358.48 g/mol. Its IUPAC name is sodium;naphthalene-1-sulfonic acid;nonane.
Molecular Properties
| Compound Name | sodium;naphthalene-1-sulfonic acid;nonane |
| PubChem CID | 159063817 |
| Molecular Formula | C19H27NaO3S |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | sodium;naphthalene-1-sulfonic acid;nonane |
| SMILES | O=S(=O)(O)c1cccc2ccccc12.[CH2-]CCCCCCCC.[Na+] |
| InChI | InChI=1S/C10H8O3S.C9H19.Na/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;1-3-5-7-9-8-6-4-2;/h1-7H,(H,11,12,13);1,3-9H2,2H3;/q;-1;+1 |
| InChIKey | DJZYQQRFSDZBHW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;naphthalene-1-sulfonic acid;nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;naphthalene-1-sulfonic acid;nonane?
The IUPAC name of sodium;naphthalene-1-sulfonic acid;nonane (CID 159063817) is sodium;naphthalene-1-sulfonic acid;nonane.
What is the SMILES notation for sodium;naphthalene-1-sulfonic acid;nonane?
The canonical SMILES for sodium;naphthalene-1-sulfonic acid;nonane is O=S(=O)(O)c1cccc2ccccc12.[CH2-]CCCCCCCC.[Na+].
What is the InChIKey of sodium;naphthalene-1-sulfonic acid;nonane?
The InChIKey is DJZYQQRFSDZBHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3S.C9H19.Na/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;1-3-5-7-9-8-6-4-2;/h1-7H,(H,11,12,13);1,3-9H2,2H3;/q;-1;+1.
What are the key properties of sodium;naphthalene-1-sulfonic acid;nonane?
sodium;naphthalene-1-sulfonic acid;nonane has a molecular weight of 358.48 g/mol, XLogP of 2.66, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;naphthalene-1-sulfonic acid;nonane is sourced from PubChem (CID 159063817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).