C10H8O7S2 — CID 21259642
5-hydroxynaphthalene-1,7-disulfonic acid (PubChem CID 21259642) has the molecular formula C10H8O7S2 and a molecular weight of 304.30 g/mol. Its IUPAC name is 5-hydroxynaphthalene-1,7-disulfonic acid.
| Compound Name | 5-hydroxynaphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 21259642 |
| Molecular Formula | C10H8O7S2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 5-hydroxynaphthalene-1,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2cccc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C10H8O7S2/c11-9-5-6(18(12,13)14)4-8-7(9)2-1-3-10(8)19(15,16)17/h1-5,11H,(H,12,13,14)(H,15,16,17) |
| InChIKey | WCSDABYIQOLLOV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|