C12H10ClNO5S — CID 154373484
8-[(2-chloroacetyl)amino]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 154373484) has the molecular formula C12H10ClNO5S and a molecular weight of 315.73 g/mol. Its IUPAC name is 8-[(2-chloroacetyl)amino]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 8-[(2-chloroacetyl)amino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 154373484 |
| Molecular Formula | C12H10ClNO5S |
| Molecular Weight | 315.73 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 8-[(2-chloroacetyl)amino]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | O=C(CCl)Nc1cccc2c(O)cc(S(=O)(=O)O)cc12 |
| InChI | InChI=1S/C12H10ClNO5S/c13-6-12(16)14-10-3-1-2-8-9(10)4-7(5-11(8)15)20(17,18)19/h1-5,15H,6H2,(H,14,16)(H,17,18,19) |
| InChIKey | FSPFRDRUCUDVJR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.73 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|