C21H16N2O9S2 — CID 139768544
8-[carbamoyl-(5-hydroxy-7-sulfonaphthalen-1-yl)amino]-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 139768544) has the molecular formula C21H16N2O9S2 and a molecular weight of 504.50 g/mol. Its IUPAC name is 8-[carbamoyl-(5-hydroxy-7-sulfonaphthalen-1-yl)amino]-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 8-[carbamoyl-(5-hydroxy-7-sulfonaphthalen-1-yl)amino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 139768544 |
| Molecular Formula | C21H16N2O9S2 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | 8-[carbamoyl-(5-hydroxy-7-sulfonaphthalen-1-yl)amino]-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | NC(=O)N(c1cccc2c(O)cc(S(=O)(=O)O)cc12)c1cccc2c(O)cc(S(=O)(=O)O)cc12 |
| InChI | InChI=1S/C21H16N2O9S2/c22-21(26)23(17-5-1-3-13-15(17)7-11(9-19(13)24)33(27,28)29)18-6-2-4-14-16(18)8-12(10-20(14)25)34(30,31)32/h1-10,24-25H,(H2,22,26)(H,27,28,29)(H,30,31,32) |
| InChIKey | OEDWMXCLJVYVMQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 195.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|