C12H11NO5S — CID 19736188
7-acetyl-8-amino-4-hydroxynaphthalene-2-sulfonic acid (PubChem CID 19736188) has the molecular formula C12H11NO5S and a molecular weight of 281.29 g/mol. Its IUPAC name is 7-acetyl-8-amino-4-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-acetyl-8-amino-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 19736188 |
| Molecular Formula | C12H11NO5S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 7-acetyl-8-amino-4-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CC(=O)c1ccc2c(O)cc(S(=O)(=O)O)cc2c1N |
| InChI | InChI=1S/C12H11NO5S/c1-6(14)8-2-3-9-10(12(8)13)4-7(5-11(9)15)19(16,17)18/h2-5,15H,13H2,1H3,(H,16,17,18) |
| InChIKey | KIXKGQNGJKDYBT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|