C14H10O5S — CID 141399647
4,9-dihydroxyanthracene-2-sulfonic acid (PubChem CID 141399647) has the molecular formula C14H10O5S and a molecular weight of 290.30 g/mol. Its IUPAC name is 4,9-dihydroxyanthracene-2-sulfonic acid.
| Compound Name | 4,9-dihydroxyanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 141399647 |
| Molecular Formula | C14H10O5S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 4,9-dihydroxyanthracene-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2cc3ccccc3c(O)c2c1 |
| InChI | InChI=1S/C14H10O5S/c15-13-7-9(20(17,18)19)6-12-11(13)5-8-3-1-2-4-10(8)14(12)16/h1-7,15-16H,(H,17,18,19) |
| InChIKey | WHGIFOUKXOITDX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|