C10H8Na2O8S2 — CID 87256464
CID 87256464 (PubChem CID 87256464) has the molecular formula C10H8Na2O8S2 and a molecular weight of 366.28 g/mol.
| Compound Name | CID 87256464 |
|---|---|
| PubChem CID | 87256464 |
| Molecular Formula | C10H8Na2O8S2 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1ccc2cc(O)c(S(=O)(=O)O)c(O)c2c1.[Na].[Na] |
| InChI | InChI=1S/C10H8O8S2.2Na/c11-8-3-5-1-2-6(19(13,14)15)4-7(5)9(12)10(8)20(16,17)18;;/h1-4,11-12H,(H,13,14,15)(H,16,17,18);; |
| InChIKey | FSJZLKPYOSCPRL-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|