C13H13NO5S — CID 54489809
7-[acetyl(methyl)amino]-8-hydroxynaphthalene-2-sulfonic acid (PubChem CID 54489809) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is 7-[acetyl(methyl)amino]-8-hydroxynaphthalene-2-sulfonic acid.
| Compound Name | 7-[acetyl(methyl)amino]-8-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 54489809 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 7-[acetyl(methyl)amino]-8-hydroxynaphthalene-2-sulfonic acid |
| SMILES | CC(=O)N(C)c1ccc2ccc(S(=O)(=O)O)cc2c1O |
| InChI | InChI=1S/C13H13NO5S/c1-8(15)14(2)12-6-4-9-3-5-10(20(17,18)19)7-11(9)13(12)16/h3-7,16H,1-2H3,(H,17,18,19) |
| InChIKey | XUXPFNQNYNSHER-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|