C14H13NO11S2 — CID 23422692
2-[carboxymethyl-(8-hydroxy-4,6-disulfonaphthalen-1-yl)amino]acetic acid (PubChem CID 23422692) has the molecular formula C14H13NO11S2 and a molecular weight of 435.39 g/mol. Its IUPAC name is 2-[carboxymethyl-(8-hydroxy-4,6-disulfonaphthalen-1-yl)amino]acetic acid.
| Compound Name | 2-[carboxymethyl-(8-hydroxy-4,6-disulfonaphthalen-1-yl)amino]acetic acid |
|---|---|
| PubChem CID | 23422692 |
| Molecular Formula | C14H13NO11S2 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | 2-[carboxymethyl-(8-hydroxy-4,6-disulfonaphthalen-1-yl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)c1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(O)c12 |
| InChI | InChI=1S/C14H13NO11S2/c16-10-4-7(27(21,22)23)3-8-11(28(24,25)26)2-1-9(14(8)10)15(5-12(17)18)6-13(19)20/h1-4,16H,5-6H2,(H,17,18)(H,19,20)(H,21,22,23)(H,24,25,26) |
| InChIKey | QITRTAXHZHQJSI-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 206.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|