About 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid
4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid (PubChem CID 19366271) has the molecular formula C16H13NO9S3
and a molecular weight of 459.48 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid.
Molecular Properties
| Compound Name | 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid |
| PubChem CID | 19366271 |
| Molecular Formula | C16H13NO9S3 |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(O)c2c(NS(=O)(=O)c3ccccc3)ccc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C16H13NO9S3/c18-14-9-11(28(21,22)23)8-12-15(29(24,25)26)7-6-13(16(12)14)17-27(19,20)10-4-2-1-3-5-10/h1-9,17-18H,(H,21,22,23)(H,24,25,26) |
| InChIKey | UFCZGPVWQLHSJB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 175.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid?
The IUPAC name of 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid (CID 19366271) is 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid.
What is the SMILES notation for 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid?
The canonical SMILES for 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid is O=S(=O)(O)c1cc(O)c2c(NS(=O)(=O)c3ccccc3)ccc(S(=O)(=O)O)c2c1.
What is the InChIKey of 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid?
The InChIKey is UFCZGPVWQLHSJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO9S3/c18-14-9-11(28(21,22)23)8-12-15(29(24,25)26)7-6-13(16(12)14)17-27(19,20)10-4-2-1-3-5-10/h1-9,17-18H,(H,21,22,23)(H,24,25,26).
What are the key properties of 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid?
4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid has a molecular weight of 459.48 g/mol, XLogP of 1.84, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzenesulfonamido)-5-hydroxynaphthalene-1,7-disulfonic acid is sourced from PubChem (CID 19366271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).