C16H14N2O11S4 — CID 23332445
8-[(3-aminophenyl)sulfonylamino]naphthalene-1,3,5-trisulfonic acid (PubChem CID 23332445) has the molecular formula C16H14N2O11S4 and a molecular weight of 538.56 g/mol. Its IUPAC name is 8-[(3-aminophenyl)sulfonylamino]naphthalene-1,3,5-trisulfonic acid.
| Compound Name | 8-[(3-aminophenyl)sulfonylamino]naphthalene-1,3,5-trisulfonic acid |
|---|---|
| PubChem CID | 23332445 |
| Molecular Formula | C16H14N2O11S4 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 537.95 |
| IUPAC Name | 8-[(3-aminophenyl)sulfonylamino]naphthalene-1,3,5-trisulfonic acid |
| SMILES | Nc1cccc(S(=O)(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)c1 |
| InChI | InChI=1S/C16H14N2O11S4/c17-9-2-1-3-10(6-9)30(19,20)18-13-4-5-14(32(24,25)26)12-7-11(31(21,22)23)8-15(16(12)13)33(27,28)29/h1-8,18H,17H2,(H,21,22,23)(H,24,25,26)(H,27,28,29) |
| InChIKey | RQWLGLIMPYFKLP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 235.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|