C17H14N2O13S4 — CID 23335189
8-[(2-methyl-4-nitrophenyl)sulfonylamino]naphthalene-1,3,5-trisulfonic acid (PubChem CID 23335189) has the molecular formula C17H14N2O13S4 and a molecular weight of 582.57 g/mol. Its IUPAC name is 8-[(2-methyl-4-nitrophenyl)sulfonylamino]naphthalene-1,3,5-trisulfonic acid.
| Compound Name | 8-[(2-methyl-4-nitrophenyl)sulfonylamino]naphthalene-1,3,5-trisulfonic acid |
|---|---|
| PubChem CID | 23335189 |
| Molecular Formula | C17H14N2O13S4 |
| Molecular Weight | 582.57 g/mol |
| Exact Mass | 581.94 |
| IUPAC Name | 8-[(2-methyl-4-nitrophenyl)sulfonylamino]naphthalene-1,3,5-trisulfonic acid |
| SMILES | Cc1cc([N+](=O)[O-])ccc1S(=O)(=O)Nc1ccc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c12 |
| InChI | InChI=1S/C17H14N2O13S4/c1-9-6-10(19(20)21)2-4-14(9)33(22,23)18-13-3-5-15(35(27,28)29)12-7-11(34(24,25)26)8-16(17(12)13)36(30,31)32/h2-8,18H,1H3,(H,24,25,26)(H,27,28,29)(H,30,31,32) |
| InChIKey | LAIMFGYVXLWGFR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 252.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.57 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|