C17H12N2O15S4 — CID 54062836
8-[(5-nitro-2-sulfobenzoyl)amino]naphthalene-1,4,6-trisulfonic acid (PubChem CID 54062836) has the molecular formula C17H12N2O15S4 and a molecular weight of 612.55 g/mol. Its IUPAC name is 8-[(5-nitro-2-sulfobenzoyl)amino]naphthalene-1,4,6-trisulfonic acid.
| Compound Name | 8-[(5-nitro-2-sulfobenzoyl)amino]naphthalene-1,4,6-trisulfonic acid |
|---|---|
| PubChem CID | 54062836 |
| Molecular Formula | C17H12N2O15S4 |
| Molecular Weight | 612.55 g/mol |
| Exact Mass | 611.91 |
| IUPAC Name | 8-[(5-nitro-2-sulfobenzoyl)amino]naphthalene-1,4,6-trisulfonic acid |
| SMILES | O=C(Nc1cc(S(=O)(=O)O)cc2c(S(=O)(=O)O)ccc(S(=O)(=O)O)c12)c1cc([N+](=O)[O-])ccc1S(=O)(=O)O |
| InChI | InChI=1S/C17H12N2O15S4/c20-17(11-5-8(19(21)22)1-2-14(11)37(29,30)31)18-12-7-9(35(23,24)25)6-10-13(36(26,27)28)3-4-15(16(10)12)38(32,33)34/h1-7H,(H,18,20)(H,23,24,25)(H,26,27,28)(H,29,30,31)(H,32,33,34) |
| InChIKey | MAYCEMPKPYGYHE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 289.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.55 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|