About sodium;hydride;4-nitro-2-sulfobenzoic acid
sodium;hydride;4-nitro-2-sulfobenzoic acid (PubChem CID 173234399) has the molecular formula C7H6NNaO7S
and a molecular weight of 271.18 g/mol. Its IUPAC name is sodium;hydride;4-nitro-2-sulfobenzoic acid.
Molecular Properties
| Compound Name | sodium;hydride;4-nitro-2-sulfobenzoic acid |
| PubChem CID | 173234399 |
| Molecular Formula | C7H6NNaO7S |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | sodium;hydride;4-nitro-2-sulfobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C7H5NO7S.Na.H/c9-7(10)5-2-1-4(8(11)12)3-6(5)16(13,14)15;;/h1-3H,(H,9,10)(H,13,14,15);;/q;+1;-1 |
| InChIKey | FBKPMBTZQOWIIM-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 134.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;4-nitro-2-sulfobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;4-nitro-2-sulfobenzoic acid?
The IUPAC name of sodium;hydride;4-nitro-2-sulfobenzoic acid (CID 173234399) is sodium;hydride;4-nitro-2-sulfobenzoic acid.
What is the SMILES notation for sodium;hydride;4-nitro-2-sulfobenzoic acid?
The canonical SMILES for sodium;hydride;4-nitro-2-sulfobenzoic acid is O=C(O)c1ccc([N+](=O)[O-])cc1S(=O)(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;4-nitro-2-sulfobenzoic acid?
The InChIKey is FBKPMBTZQOWIIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO7S.Na.H/c9-7(10)5-2-1-4(8(11)12)3-6(5)16(13,14)15;;/h1-3H,(H,9,10)(H,13,14,15);;/q;+1;-1.
What are the key properties of sodium;hydride;4-nitro-2-sulfobenzoic acid?
sodium;hydride;4-nitro-2-sulfobenzoic acid has a molecular weight of 271.18 g/mol, XLogP of -2.34, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;4-nitro-2-sulfobenzoic acid is sourced from PubChem (CID 173234399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).