C8H7NaO7S — CID 173004511
sodium;hydride;2-sulfoterephthalic acid (PubChem CID 173004511) has the molecular formula C8H7NaO7S and a molecular weight of 270.19 g/mol. Its IUPAC name is sodium;hydride;2-sulfoterephthalic acid.
| Compound Name | sodium;hydride;2-sulfoterephthalic acid |
|---|---|
| PubChem CID | 173004511 |
| Molecular Formula | C8H7NaO7S |
| Molecular Weight | 270.19 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | sodium;hydride;2-sulfoterephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c(S(=O)(=O)O)c1.[H-].[Na+] |
| InChI | InChI=1S/C8H6O7S.Na.H/c9-7(10)4-1-2-5(8(11)12)6(3-4)16(13,14)15;;/h1-3H,(H,9,10)(H,11,12)(H,13,14,15);;/q;+1;-1 |
| InChIKey | NBVFFDDGDHZGMO-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.19 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|