C16H23NaO7S — CID 173139369
sodium;hydride;4-octan-4-yloxycarbonyl-3-sulfobenzoic acid (PubChem CID 173139369) has the molecular formula C16H23NaO7S and a molecular weight of 382.41 g/mol. Its IUPAC name is sodium;hydride;4-octan-4-yloxycarbonyl-3-sulfobenzoic acid.
| Compound Name | sodium;hydride;4-octan-4-yloxycarbonyl-3-sulfobenzoic acid |
|---|---|
| PubChem CID | 173139369 |
| Molecular Formula | C16H23NaO7S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | sodium;hydride;4-octan-4-yloxycarbonyl-3-sulfobenzoic acid |
| SMILES | CCCCC(CCC)OC(=O)c1ccc(C(=O)O)cc1S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C16H22O7S.Na.H/c1-3-5-7-12(6-4-2)23-16(19)13-9-8-11(15(17)18)10-14(13)24(20,21)22;;/h8-10,12H,3-7H2,1-2H3,(H,17,18)(H,20,21,22);;/q;+1;-1 |
| InChIKey | UWCNTPGYJMELFM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|